C14H11F2NO3S2 — CID 57248006
2-(2,4-difluorophenyl)sulfanyl-4-(2-oxoethyl)-1-(sulfinoamino)benzene (PubChem CID 57248006) has the molecular formula C14H11F2NO3S2 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-4-(2-oxoethyl)-1-(sulfinoamino)benzene.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-4-(2-oxoethyl)-1-(sulfinoamino)benzene |
|---|---|
| PubChem CID | 57248006 |
| Molecular Formula | C14H11F2NO3S2 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-4-(2-oxoethyl)-1-(sulfinoamino)benzene |
| SMILES | O=CCc1ccc(NS(=O)O)c(Sc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C14H11F2NO3S2/c15-10-2-4-13(11(16)8-10)21-14-7-9(5-6-18)1-3-12(14)17-22(19)20/h1-4,6-8,17H,5H2,(H,19,20) |
| InChIKey | RKAMVWOCTZJZHN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|