C10H8F2O2S — CID 79889088
methyl 3-(2,4-difluorophenyl)sulfanylprop-2-enoate (PubChem CID 79889088) has the molecular formula C10H8F2O2S and a molecular weight of 230.24 g/mol. Its IUPAC name is methyl 3-(2,4-difluorophenyl)sulfanylprop-2-enoate.
| Compound Name | methyl 3-(2,4-difluorophenyl)sulfanylprop-2-enoate |
|---|---|
| PubChem CID | 79889088 |
| Molecular Formula | C10H8F2O2S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | methyl 3-(2,4-difluorophenyl)sulfanylprop-2-enoate |
| SMILES | COC(=O)C=CSc1ccc(F)cc1F |
| InChI | InChI=1S/C10H8F2O2S/c1-14-10(13)4-5-15-9-3-2-7(11)6-8(9)12/h2-6H,1H3 |
| InChIKey | UHPLLNYZRXALFU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|