C15H12BrF2NO3S2 — CID 10026012
N-[5-(2-bromoacetyl)-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide (PubChem CID 10026012) has the molecular formula C15H12BrF2NO3S2 and a molecular weight of 436.30 g/mol. Its IUPAC name is N-[5-(2-bromoacetyl)-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide.
| Compound Name | N-[5-(2-bromoacetyl)-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 10026012 |
| Molecular Formula | C15H12BrF2NO3S2 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 434.94 |
| IUPAC Name | N-[5-(2-bromoacetyl)-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(=O)CBr)ccc1Sc1ccc(F)cc1F |
| InChI | InChI=1S/C15H12BrF2NO3S2/c1-24(21,22)19-12-6-9(13(20)8-16)2-4-15(12)23-14-5-3-10(17)7-11(14)18/h2-7,19H,8H2,1H3 |
| InChIKey | KTFFYDWCRQLGDJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|