C27H22ClF3N4O2 — CID 19852872
5-(4-chlorophenyl)-4-(3-cyanopropyl)-4-phenyl-N-[4-(trifluoromethoxy)phenyl]-3H-pyrazole-2-carboxamide (PubChem CID 19852872) has the molecular formula C27H22ClF3N4O2 and a molecular weight of 526.95 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-(3-cyanopropyl)-4-phenyl-N-[4-(trifluoromethoxy)phenyl]-3H-pyrazole-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-4-(3-cyanopropyl)-4-phenyl-N-[4-(trifluoromethoxy)phenyl]-3H-pyrazole-2-carboxamide |
|---|---|
| PubChem CID | 19852872 |
| Molecular Formula | C27H22ClF3N4O2 |
| Molecular Weight | 526.95 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 5-(4-chlorophenyl)-4-(3-cyanopropyl)-4-phenyl-N-[4-(trifluoromethoxy)phenyl]-3H-pyrazole-2-carboxamide |
| SMILES | N#CCCCC1(c2ccccc2)CN(C(=O)Nc2ccc(OC(F)(F)F)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22ClF3N4O2/c28-21-10-8-19(9-11-21)24-26(16-4-5-17-32,20-6-2-1-3-7-20)18-35(34-24)25(36)33-22-12-14-23(15-13-22)37-27(29,30)31/h1-3,6-15H,4-5,16,18H2,(H,33,36) |
| InChIKey | QNOJSLZJTSYFPR-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 77.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.95 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|