C7H11N3O2S — CID 19855284
4-(5-nitro-1,2-thiazol-4-yl)butan-1-amine (PubChem CID 19855284) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 4-(5-nitro-1,2-thiazol-4-yl)butan-1-amine.
| Compound Name | 4-(5-nitro-1,2-thiazol-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 19855284 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 4-(5-nitro-1,2-thiazol-4-yl)butan-1-amine |
| SMILES | NCCCCc1cnsc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H11N3O2S/c8-4-2-1-3-6-5-9-13-7(6)10(11)12/h5H,1-4,8H2 |
| InChIKey | KYYQNIZZMZRUBI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|