C14H13N3O5S — CID 19855753
4-(4,7-dimethyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-2-yl)benzenesulfonic acid (PubChem CID 19855753) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is 4-(4,7-dimethyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-2-yl)benzenesulfonic acid.
| Compound Name | 4-(4,7-dimethyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 19855753 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4-(4,7-dimethyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-2-yl)benzenesulfonic acid |
| SMILES | Cc1cc(=O)n(C)c2[nH]n(-c3ccc(S(=O)(=O)O)cc3)c(=O)c12 |
| InChI | InChI=1S/C14H13N3O5S/c1-8-7-11(18)16(2)13-12(8)14(19)17(15-13)9-3-5-10(6-4-9)23(20,21)22/h3-7,15H,1-2H3,(H,20,21,22) |
| InChIKey | HPEKSLKNHZCHMG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|