C23H21N3O6 — CID 90992622
ethyl 4-[2-[4-(hydroperoxymethyl)phenyl]-4-methyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoate (PubChem CID 90992622) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is ethyl 4-[2-[4-(hydroperoxymethyl)phenyl]-4-methyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoate.
| Compound Name | ethyl 4-[2-[4-(hydroperoxymethyl)phenyl]-4-methyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoate |
|---|---|
| PubChem CID | 90992622 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | ethyl 4-[2-[4-(hydroperoxymethyl)phenyl]-4-methyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(=O)cc(C)c3c(=O)n(-c4ccc(COO)cc4)[nH]c32)cc1 |
| InChI | InChI=1S/C23H21N3O6/c1-3-31-23(29)16-6-10-17(11-7-16)25-19(27)12-14(2)20-21(25)24-26(22(20)28)18-8-4-15(5-9-18)13-32-30/h4-12,24,30H,3,13H2,1-2H3 |
| InChIKey | SQCGZKMAAQRWPP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|