C22H23NO3 — CID 39768405
ethyl 4-[(4,6,8-trimethyl-2-oxoquinolin-1-yl)methyl]benzoate (PubChem CID 39768405) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 4-[(4,6,8-trimethyl-2-oxoquinolin-1-yl)methyl]benzoate.
| Compound Name | ethyl 4-[(4,6,8-trimethyl-2-oxoquinolin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 39768405 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | ethyl 4-[(4,6,8-trimethyl-2-oxoquinolin-1-yl)methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(Cn2c(=O)cc(C)c3cc(C)cc(C)c32)cc1 |
| InChI | InChI=1S/C22H23NO3/c1-5-26-22(25)18-8-6-17(7-9-18)13-23-20(24)12-15(3)19-11-14(2)10-16(4)21(19)23/h6-12H,5,13H2,1-4H3 |
| InChIKey | PODLORPKTJRPHD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |