C21H21NO3 — CID 39768207
ethyl 4-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzoate (PubChem CID 39768207) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is ethyl 4-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzoate.
| Compound Name | ethyl 4-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 39768207 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | ethyl 4-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(Cn2c(=O)cc(C)c3cccc(C)c32)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-4-25-21(24)17-10-8-16(9-11-17)13-22-19(23)12-15(3)18-7-5-6-14(2)20(18)22/h5-12H,4,13H2,1-3H3 |
| InChIKey | AKXOVKXBACGTLC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |