C22H25NO2 — CID 39768400
4,6,8-trimethyl-1-(4-phenoxybutyl)quinolin-2-one (PubChem CID 39768400) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4,6,8-trimethyl-1-(4-phenoxybutyl)quinolin-2-one.
| Compound Name | 4,6,8-trimethyl-1-(4-phenoxybutyl)quinolin-2-one |
|---|---|
| PubChem CID | 39768400 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 4,6,8-trimethyl-1-(4-phenoxybutyl)quinolin-2-one |
| SMILES | Cc1cc(C)c2c(c1)c(C)cc(=O)n2CCCCOc1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-16-13-18(3)22-20(14-16)17(2)15-21(24)23(22)11-7-8-12-25-19-9-5-4-6-10-19/h4-6,9-10,13-15H,7-8,11-12H2,1-3H3 |
| InChIKey | UWXBTHFHCQYXEJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|