C17H22N2O3 — CID 39768430
N-(2-methoxyethyl)-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)acetamide (PubChem CID 39768430) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 39768430 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-(2-methoxyethyl)-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)acetamide |
| SMILES | COCCNC(=O)Cn1c(=O)cc(C)c2cc(C)cc(C)c21 |
| InChI | InChI=1S/C17H22N2O3/c1-11-7-13(3)17-14(8-11)12(2)9-16(21)19(17)10-15(20)18-5-6-22-4/h7-9H,5-6,10H2,1-4H3,(H,18,20) |
| InChIKey | XQVVGAGCMAOYLQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|