C28H23N3O6 — CID 91560236
ethyl 4-[2-[4-(hydroperoxymethyl)phenyl]-3,6-dioxo-4-phenyl-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoate (PubChem CID 91560236) has the molecular formula C28H23N3O6 and a molecular weight of 497.51 g/mol. Its IUPAC name is ethyl 4-[2-[4-(hydroperoxymethyl)phenyl]-3,6-dioxo-4-phenyl-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoate.
| Compound Name | ethyl 4-[2-[4-(hydroperoxymethyl)phenyl]-3,6-dioxo-4-phenyl-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoate |
|---|---|
| PubChem CID | 91560236 |
| Molecular Formula | C28H23N3O6 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | ethyl 4-[2-[4-(hydroperoxymethyl)phenyl]-3,6-dioxo-4-phenyl-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(=O)cc(-c3ccccc3)c3c(=O)n(-c4ccc(COO)cc4)[nH]c32)cc1 |
| InChI | InChI=1S/C28H23N3O6/c1-2-36-28(34)20-10-14-21(15-11-20)30-24(32)16-23(19-6-4-3-5-7-19)25-26(30)29-31(27(25)33)22-12-8-18(9-13-22)17-37-35/h3-16,29,35H,2,17H2,1H3 |
| InChIKey | NWPKZZZKBNOENB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|