C10H12N2O2S — CID 19858409
[[2-(4-methylphenyl)ethanethioyl]amino]carbamic acid (PubChem CID 19858409) has the molecular formula C10H12N2O2S and a molecular weight of 224.29 g/mol. Its IUPAC name is [[2-(4-methylphenyl)ethanethioyl]amino]carbamic acid.
| Compound Name | [[2-(4-methylphenyl)ethanethioyl]amino]carbamic acid |
|---|---|
| PubChem CID | 19858409 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | [[2-(4-methylphenyl)ethanethioyl]amino]carbamic acid |
| SMILES | Cc1ccc(CC(=S)NNC(=O)O)cc1 |
| InChI | InChI=1S/C10H12N2O2S/c1-7-2-4-8(5-3-7)6-9(15)11-12-10(13)14/h2-5,12H,6H2,1H3,(H,11,15)(H,13,14) |
| InChIKey | DLWQMKJIZXTKLK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|