C12H20N2O — CID 19861688
4-N-(4-methoxybutan-2-yl)-2-methylbenzene-1,4-diamine (PubChem CID 19861688) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-N-(4-methoxybutan-2-yl)-2-methylbenzene-1,4-diamine.
| Compound Name | 4-N-(4-methoxybutan-2-yl)-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 19861688 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-N-(4-methoxybutan-2-yl)-2-methylbenzene-1,4-diamine |
| SMILES | COCCC(C)Nc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C12H20N2O/c1-9-8-11(4-5-12(9)13)14-10(2)6-7-15-3/h4-5,8,10,14H,6-7,13H2,1-3H3 |
| InChIKey | ODBPSZNWNMGYHF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|