C18H35N2O8PS — CID 19863476
N-[4-[2-(diethylamino)-3-(2-methylpropoxy)propoxy]phenyl]methanesulfonamide;phosphoric acid (PubChem CID 19863476) has the molecular formula C18H35N2O8PS and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[4-[2-(diethylamino)-3-(2-methylpropoxy)propoxy]phenyl]methanesulfonamide;phosphoric acid.
| Compound Name | N-[4-[2-(diethylamino)-3-(2-methylpropoxy)propoxy]phenyl]methanesulfonamide;phosphoric acid |
|---|---|
| PubChem CID | 19863476 |
| Molecular Formula | C18H35N2O8PS |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-[4-[2-(diethylamino)-3-(2-methylpropoxy)propoxy]phenyl]methanesulfonamide;phosphoric acid |
| SMILES | CCN(CC)C(COCC(C)C)COc1ccc(NS(C)(=O)=O)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C18H32N2O4S.H3O4P/c1-6-20(7-2)17(13-23-12-15(3)4)14-24-18-10-8-16(9-11-18)19-25(5,21)22;1-5(2,3)4/h8-11,15,17,19H,6-7,12-14H2,1-5H3;(H3,1,2,3,4) |
| InChIKey | MUJIBNIUQCCVDH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|