C10H14ClNO3S — CID 84760646
N-[4-(2-methylpropoxy)phenyl]sulfamoyl chloride (PubChem CID 84760646) has the molecular formula C10H14ClNO3S and a molecular weight of 263.75 g/mol. Its IUPAC name is N-[4-(2-methylpropoxy)phenyl]sulfamoyl chloride.
| Compound Name | N-[4-(2-methylpropoxy)phenyl]sulfamoyl chloride |
|---|---|
| PubChem CID | 84760646 |
| Molecular Formula | C10H14ClNO3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | N-[4-(2-methylpropoxy)phenyl]sulfamoyl chloride |
| SMILES | CC(C)COc1ccc(NS(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C10H14ClNO3S/c1-8(2)7-15-10-5-3-9(4-6-10)12-16(11,13)14/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | MCDMSCNQIHPVIX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |