C22H32N2O2 — CID 54808031
N,N'-bis[4-(2-methylpropoxy)phenyl]ethane-1,2-diamine (PubChem CID 54808031) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N,N'-bis[4-(2-methylpropoxy)phenyl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[4-(2-methylpropoxy)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 54808031 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | N,N'-bis[4-(2-methylpropoxy)phenyl]ethane-1,2-diamine |
| SMILES | CC(C)COc1ccc(NCCNc2ccc(OCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H32N2O2/c1-17(2)15-25-21-9-5-19(6-10-21)23-13-14-24-20-7-11-22(12-8-20)26-16-18(3)4/h5-12,17-18,23-24H,13-16H2,1-4H3 |
| InChIKey | UZONKXIWUUUAEG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|