C14H24N2O — CID 83946331
1-N-[4-(2-methylpropoxy)phenyl]butane-1,2-diamine (PubChem CID 83946331) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-N-[4-(2-methylpropoxy)phenyl]butane-1,2-diamine.
| Compound Name | 1-N-[4-(2-methylpropoxy)phenyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 83946331 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-N-[4-(2-methylpropoxy)phenyl]butane-1,2-diamine |
| SMILES | CCC(N)CNc1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C14H24N2O/c1-4-12(15)9-16-13-5-7-14(8-6-13)17-10-11(2)3/h5-8,11-12,16H,4,9-10,15H2,1-3H3 |
| InChIKey | RDQAHIVXGIUWKS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|