C17H24N2OS — CID 54808541
N'-[4-(2-methylpropoxy)phenyl]-N-(thiophen-2-ylmethyl)ethane-1,2-diamine (PubChem CID 54808541) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is N'-[4-(2-methylpropoxy)phenyl]-N-(thiophen-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-[4-(2-methylpropoxy)phenyl]-N-(thiophen-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54808541 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N'-[4-(2-methylpropoxy)phenyl]-N-(thiophen-2-ylmethyl)ethane-1,2-diamine |
| SMILES | CC(C)COc1ccc(NCCNCc2cccs2)cc1 |
| InChI | InChI=1S/C17H24N2OS/c1-14(2)13-20-16-7-5-15(6-8-16)19-10-9-18-12-17-4-3-11-21-17/h3-8,11,14,18-19H,9-10,12-13H2,1-2H3 |
| InChIKey | HNUFOTVTORIUBC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|