C10H9Cl3F2O2 — CID 19865481
1-ethoxy-4-(2,2,2-trichloro-1,1-difluoroethoxy)benzene (PubChem CID 19865481) has the molecular formula C10H9Cl3F2O2 and a molecular weight of 305.54 g/mol. Its IUPAC name is 1-ethoxy-4-(2,2,2-trichloro-1,1-difluoroethoxy)benzene.
| Compound Name | 1-ethoxy-4-(2,2,2-trichloro-1,1-difluoroethoxy)benzene |
|---|---|
| PubChem CID | 19865481 |
| Molecular Formula | C10H9Cl3F2O2 |
| Molecular Weight | 305.54 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | 1-ethoxy-4-(2,2,2-trichloro-1,1-difluoroethoxy)benzene |
| SMILES | CCOc1ccc(OC(F)(F)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C10H9Cl3F2O2/c1-2-16-7-3-5-8(6-4-7)17-10(14,15)9(11,12)13/h3-6H,2H2,1H3 |
| InChIKey | JENJVSLRCPUBCX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|