C18H17ClN2S — CID 19865757
5-(3-chlorophenyl)-3,6,8-trimethyl-1,3-dihydro-1,4-benzodiazepine-2-thione (PubChem CID 19865757) has the molecular formula C18H17ClN2S and a molecular weight of 328.87 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3,6,8-trimethyl-1,3-dihydro-1,4-benzodiazepine-2-thione.
| Compound Name | 5-(3-chlorophenyl)-3,6,8-trimethyl-1,3-dihydro-1,4-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 19865757 |
| Molecular Formula | C18H17ClN2S |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 5-(3-chlorophenyl)-3,6,8-trimethyl-1,3-dihydro-1,4-benzodiazepine-2-thione |
| SMILES | Cc1cc(C)c2c(c1)NC(=S)C(C)N=C2c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClN2S/c1-10-7-11(2)16-15(8-10)21-18(22)12(3)20-17(16)13-5-4-6-14(19)9-13/h4-9,12H,1-3H3,(H,21,22) |
| InChIKey | CBLIVTQUQTXCMU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|