C10H6F3N5 — CID 19867073
2-amino-5-(1,2,4-triazol-4-yl)-3-(trifluoromethyl)benzonitrile (PubChem CID 19867073) has the molecular formula C10H6F3N5 and a molecular weight of 253.19 g/mol. Its IUPAC name is 2-amino-5-(1,2,4-triazol-4-yl)-3-(trifluoromethyl)benzonitrile.
| Compound Name | 2-amino-5-(1,2,4-triazol-4-yl)-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 19867073 |
| Molecular Formula | C10H6F3N5 |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-amino-5-(1,2,4-triazol-4-yl)-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(-n2cnnc2)cc(C(F)(F)F)c1N |
| InChI | InChI=1S/C10H6F3N5/c11-10(12,13)8-2-7(18-4-16-17-5-18)1-6(3-14)9(8)15/h1-2,4-5H,15H2 |
| InChIKey | LFXHJCAHRIZGOB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|