C14H13F3N4O2 — CID 19867091
ethyl (E)-3-[2-amino-5-(1,2,4-triazol-4-yl)-3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 19867091) has the molecular formula C14H13F3N4O2 and a molecular weight of 326.28 g/mol. Its IUPAC name is ethyl (E)-3-[2-amino-5-(1,2,4-triazol-4-yl)-3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-amino-5-(1,2,4-triazol-4-yl)-3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19867091 |
| Molecular Formula | C14H13F3N4O2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | ethyl (E)-3-[2-amino-5-(1,2,4-triazol-4-yl)-3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(-n2cnnc2)cc(C(F)(F)F)c1N |
| InChI | InChI=1S/C14H13F3N4O2/c1-2-23-12(22)4-3-9-5-10(21-7-19-20-8-21)6-11(13(9)18)14(15,16)17/h3-8H,2,18H2,1H3/b4-3+ |
| InChIKey | KSJKJTIEARFOGE-ONEGZZNKSA-N |
| XLogP | 2.44 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|