C10H15OS- — CID 19867145
2,6,6-trimethylcyclohex-2-ene-1-carbothioate (PubChem CID 19867145) has the molecular formula C10H15OS- and a molecular weight of 183.30 g/mol. Its IUPAC name is 2,6,6-trimethylcyclohex-2-ene-1-carbothioate.
| Compound Name | 2,6,6-trimethylcyclohex-2-ene-1-carbothioate |
|---|---|
| PubChem CID | 19867145 |
| Molecular Formula | C10H15OS- |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2,6,6-trimethylcyclohex-2-ene-1-carbothioate |
| SMILES | CC1=CCCC(C)(C)C1C(=O)[S-] |
| InChI | InChI=1S/C10H16OS/c1-7-5-4-6-10(2,3)8(7)9(11)12/h5,8H,4,6H2,1-3H3,(H,11,12)/p-1 |
| InChIKey | KRWUPPNCFJEDQT-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|