C28H24O2S — CID 19869938
1-methyl-4-(1,3,3-triphenylprop-2-enylsulfonyl)benzene (PubChem CID 19869938) has the molecular formula C28H24O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-methyl-4-(1,3,3-triphenylprop-2-enylsulfonyl)benzene.
| Compound Name | 1-methyl-4-(1,3,3-triphenylprop-2-enylsulfonyl)benzene |
|---|---|
| PubChem CID | 19869938 |
| Molecular Formula | C28H24O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-methyl-4-(1,3,3-triphenylprop-2-enylsulfonyl)benzene |
| SMILES | Cc1ccc(S(=O)(=O)C(C=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24O2S/c1-22-17-19-26(20-18-22)31(29,30)28(25-15-9-4-10-16-25)21-27(23-11-5-2-6-12-23)24-13-7-3-8-14-24/h2-21,28H,1H3 |
| InChIKey | MDJHHHNVKINVLF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |