C30H26O3S — CID 139047659
(E,2S)-2-(4-methylphenyl)sulfonyl-4-phenyl-1-(4-phenylphenyl)pent-3-en-1-one (PubChem CID 139047659) has the molecular formula C30H26O3S and a molecular weight of 466.60 g/mol. Its IUPAC name is (E,2S)-2-(4-methylphenyl)sulfonyl-4-phenyl-1-(4-phenylphenyl)pent-3-en-1-one.
| Compound Name | (E,2S)-2-(4-methylphenyl)sulfonyl-4-phenyl-1-(4-phenylphenyl)pent-3-en-1-one |
|---|---|
| PubChem CID | 139047659 |
| Molecular Formula | C30H26O3S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (E,2S)-2-(4-methylphenyl)sulfonyl-4-phenyl-1-(4-phenylphenyl)pent-3-en-1-one |
| SMILES | C/C(=C\[C@@H](C(=O)c1ccc(-c2ccccc2)cc1)S(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H26O3S/c1-22-13-19-28(20-14-22)34(32,33)29(21-23(2)24-9-5-3-6-10-24)30(31)27-17-15-26(16-18-27)25-11-7-4-8-12-25/h3-21,29H,1-2H3/b23-21+/t29-/m0/s1 |
| InChIKey | RJNGUQVBNLXSGL-QWXNGLIISA-N |
| XLogP | 6.79 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |