C21H25NO3S — CID 4204809
2-(4-methylphenyl)sulfonyl-1-phenyl-3-piperidin-1-ylpropan-1-one (PubChem CID 4204809) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-1-phenyl-3-piperidin-1-ylpropan-1-one.
| Compound Name | 2-(4-methylphenyl)sulfonyl-1-phenyl-3-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 4204809 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-1-phenyl-3-piperidin-1-ylpropan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)C(CN2CCCCC2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO3S/c1-17-10-12-19(13-11-17)26(24,25)20(16-22-14-6-3-7-15-22)21(23)18-8-4-2-5-9-18/h2,4-5,8-13,20H,3,6-7,14-16H2,1H3 |
| InChIKey | RBFYUNLUTIBTEA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |