C42H42N12 — CID 19870131
5-[2-[2,3,4,5,6-pentakis(2-pyrimidin-5-ylethyl)phenyl]ethyl]pyrimidine (PubChem CID 19870131) has the molecular formula C42H42N12 and a molecular weight of 714.88 g/mol. Its IUPAC name is 5-[2-[2,3,4,5,6-pentakis(2-pyrimidin-5-ylethyl)phenyl]ethyl]pyrimidine.
| Compound Name | 5-[2-[2,3,4,5,6-pentakis(2-pyrimidin-5-ylethyl)phenyl]ethyl]pyrimidine |
|---|---|
| PubChem CID | 19870131 |
| Molecular Formula | C42H42N12 |
| Molecular Weight | 714.88 g/mol |
| Exact Mass | 714.37 |
| IUPAC Name | 5-[2-[2,3,4,5,6-pentakis(2-pyrimidin-5-ylethyl)phenyl]ethyl]pyrimidine |
| SMILES | c1ncc(CCc2c(CCc3cncnc3)c(CCc3cncnc3)c(CCc3cncnc3)c(CCc3cncnc3)c2CCc2cncnc2)cn1 |
| InChI | InChI=1S/C42H42N12/c1(31-13-43-25-44-14-31)7-37-38(8-2-32-15-45-26-46-16-32)40(10-4-34-19-49-28-50-20-34)42(12-6-36-23-53-30-54-24-36)41(11-5-35-21-51-29-52-22-35)39(37)9-3-33-17-47-27-48-18-33/h13-30H,1-12H2 |
| InChIKey | KVQKJLBFZONDHJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 154.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.88 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |