C15H19NO4S — CID 19877918
2-[2-[2-[(4-ethenylphenyl)methylsulfanyl]ethylamino]-2-oxoethoxy]acetic acid (PubChem CID 19877918) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[2-[2-[(4-ethenylphenyl)methylsulfanyl]ethylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[2-[(4-ethenylphenyl)methylsulfanyl]ethylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 19877918 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[2-[2-[(4-ethenylphenyl)methylsulfanyl]ethylamino]-2-oxoethoxy]acetic acid |
| SMILES | C=Cc1ccc(CSCCNC(=O)COCC(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO4S/c1-2-12-3-5-13(6-4-12)11-21-8-7-16-14(17)9-20-10-15(18)19/h2-6H,1,7-11H2,(H,16,17)(H,18,19) |
| InChIKey | DCLKSQKJDMEQQQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|