C12H12N4O4 — CID 19881484
(E)-4-[[(E)-4-carboxy-2-cyanobut-3-en-2-yl]diazenyl]-4-cyanopent-2-enoic acid (PubChem CID 19881484) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is (E)-4-[[(E)-4-carboxy-2-cyanobut-3-en-2-yl]diazenyl]-4-cyanopent-2-enoic acid.
| Compound Name | (E)-4-[[(E)-4-carboxy-2-cyanobut-3-en-2-yl]diazenyl]-4-cyanopent-2-enoic acid |
|---|---|
| PubChem CID | 19881484 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (E)-4-[[(E)-4-carboxy-2-cyanobut-3-en-2-yl]diazenyl]-4-cyanopent-2-enoic acid |
| SMILES | CC(C#N)(/C=C/C(=O)O)/N=N/C(C)(C#N)/C=C/C(=O)O |
| InChI | InChI=1S/C12H12N4O4/c1-11(7-13,5-3-9(17)18)15-16-12(2,8-14)6-4-10(19)20/h3-6H,1-2H3,(H,17,18)(H,19,20)/b5-3+,6-4+,16-15+ |
| InChIKey | NCSOWNCRUOEIKM-FFPVUICOSA-N |
| XLogP | 1.28 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|