C8H12O4S — CID 168744875
(E)-4-methyl-4-(2-sulfanylacetyl)oxypent-2-enoic acid (PubChem CID 168744875) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is (E)-4-methyl-4-(2-sulfanylacetyl)oxypent-2-enoic acid.
| Compound Name | (E)-4-methyl-4-(2-sulfanylacetyl)oxypent-2-enoic acid |
|---|---|
| PubChem CID | 168744875 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (E)-4-methyl-4-(2-sulfanylacetyl)oxypent-2-enoic acid |
| SMILES | CC(C)(/C=C/C(=O)O)OC(=O)CS |
| InChI | InChI=1S/C8H12O4S/c1-8(2,4-3-6(9)10)12-7(11)5-13/h3-4,13H,5H2,1-2H3,(H,9,10)/b4-3+ |
| InChIKey | SBHWJBMGNIBSTL-ONEGZZNKSA-N |
| XLogP | 0.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|