C10H14O4S3 — CID 87098375
4-sulfanyl-4-(2-sulfanylethylsulfanylmethyl)hepta-2,5-dienedioic acid (PubChem CID 87098375) has the molecular formula C10H14O4S3 and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-sulfanyl-4-(2-sulfanylethylsulfanylmethyl)hepta-2,5-dienedioic acid.
| Compound Name | 4-sulfanyl-4-(2-sulfanylethylsulfanylmethyl)hepta-2,5-dienedioic acid |
|---|---|
| PubChem CID | 87098375 |
| Molecular Formula | C10H14O4S3 |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 4-sulfanyl-4-(2-sulfanylethylsulfanylmethyl)hepta-2,5-dienedioic acid |
| SMILES | O=C(O)C=CC(S)(C=CC(=O)O)CSCCS |
| InChI | InChI=1S/C10H14O4S3/c11-8(12)1-3-10(16,4-2-9(13)14)7-17-6-5-15/h1-4,15-16H,5-7H2,(H,11,12)(H,13,14) |
| InChIKey | ZIWWVIINUHZATN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|