C11H17NO5S — CID 91068662
5-amino-5-(butylsulfanylmethyl)-4-oxohex-2-enedioic acid (PubChem CID 91068662) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is 5-amino-5-(butylsulfanylmethyl)-4-oxohex-2-enedioic acid.
| Compound Name | 5-amino-5-(butylsulfanylmethyl)-4-oxohex-2-enedioic acid |
|---|---|
| PubChem CID | 91068662 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-amino-5-(butylsulfanylmethyl)-4-oxohex-2-enedioic acid |
| SMILES | CCCCSCC(N)(C(=O)O)C(=O)C=CC(=O)O |
| InChI | InChI=1S/C11H17NO5S/c1-2-3-6-18-7-11(12,10(16)17)8(13)4-5-9(14)15/h4-5H,2-3,6-7,12H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | AYYMZMOUYFDWRN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|