C12H25NO2S — CID 91364833
(2R)-2-amino-2-(2-butylsulfanylethyl)-3,3-dimethylbutanoic acid (PubChem CID 91364833) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is (2R)-2-amino-2-(2-butylsulfanylethyl)-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-amino-2-(2-butylsulfanylethyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 91364833 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (2R)-2-amino-2-(2-butylsulfanylethyl)-3,3-dimethylbutanoic acid |
| SMILES | CCCCSCC[C@](N)(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H25NO2S/c1-5-6-8-16-9-7-12(13,10(14)15)11(2,3)4/h5-9,13H2,1-4H3,(H,14,15)/t12-/m0/s1 |
| InChIKey | MLSQMGHAIFDIEF-LBPRGKRZSA-N |
| XLogP | 2.74 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|