(2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid

C7H16N2O2 — CID 57159818

IUPAC(2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid
SMILESCC(C)(C)[C@](N)(CN)C(=O)O
InChIInChI=1S/C7H16N2O2/c1-6(2,3)7(9,4-8)5(10)11/h4,8-9H2,1-3H3,(H,10,11)/t7-/m0/s1
InChIKeyCPNWCJOKMJICMZ-ZETCQYMHSA-N
MW160.22 g/mol
LogP-0.23
Rot. Bonds2

About (2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid

(2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid (PubChem CID 57159818) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is (2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid.

Molecular Properties

Compound Name(2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid
PubChem CID57159818
Molecular FormulaC7H16N2O2
Molecular Weight160.22 g/mol
Exact Mass160.12
IUPAC Name(2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid
SMILESCC(C)(C)[C@](N)(CN)C(=O)O
InChIInChI=1S/C7H16N2O2/c1-6(2,3)7(9,4-8)5(10)11/h4,8-9H2,1-3H3,(H,10,11)/t7-/m0/s1
InChIKeyCPNWCJOKMJICMZ-ZETCQYMHSA-N
XLogP-0.23
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.22
LogP ≤ 5-0.23
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid?
The IUPAC name of (2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid (CID 57159818) is (2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid.
What is the SMILES notation for (2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid?
The canonical SMILES for (2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid is CC(C)(C)[C@](N)(CN)C(=O)O.
What is the InChIKey of (2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid?
The InChIKey is CPNWCJOKMJICMZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-6(2,3)7(9,4-8)5(10)11/h4,8-9H2,1-3H3,(H,10,11)/t7-/m0/s1.
What are the key properties of (2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid?
(2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid has a molecular weight of 160.22 g/mol, XLogP of -0.23, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-(aminomethyl)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 57159818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).