C8H12O6S2 — CID 174060729
[1,2-dihydroxy-1-(2-sulfanylacetyl)oxybut-2-enyl] 2-sulfanylacetate (PubChem CID 174060729) has the molecular formula C8H12O6S2 and a molecular weight of 268.31 g/mol. Its IUPAC name is [1,2-dihydroxy-1-(2-sulfanylacetyl)oxybut-2-enyl] 2-sulfanylacetate.
| Compound Name | [1,2-dihydroxy-1-(2-sulfanylacetyl)oxybut-2-enyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 174060729 |
| Molecular Formula | C8H12O6S2 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | [1,2-dihydroxy-1-(2-sulfanylacetyl)oxybut-2-enyl] 2-sulfanylacetate |
| SMILES | CC=C(O)C(O)(OC(=O)CS)OC(=O)CS |
| InChI | InChI=1S/C8H12O6S2/c1-2-5(9)8(12,13-6(10)3-15)14-7(11)4-16/h2,9,12,15-16H,3-4H2,1H3 |
| InChIKey | WWBWNXDMFVYICB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|