C12H20O9S3 — CID 141277067
[1-hydroxy-2-[hydroxy-bis[(2-sulfanylacetyl)oxy]methyl]-2-(hydroxymethyl)butyl] 2-sulfanylacetate (PubChem CID 141277067) has the molecular formula C12H20O9S3 and a molecular weight of 404.48 g/mol. Its IUPAC name is [1-hydroxy-2-[hydroxy-bis[(2-sulfanylacetyl)oxy]methyl]-2-(hydroxymethyl)butyl] 2-sulfanylacetate.
| Compound Name | [1-hydroxy-2-[hydroxy-bis[(2-sulfanylacetyl)oxy]methyl]-2-(hydroxymethyl)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 141277067 |
| Molecular Formula | C12H20O9S3 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | [1-hydroxy-2-[hydroxy-bis[(2-sulfanylacetyl)oxy]methyl]-2-(hydroxymethyl)butyl] 2-sulfanylacetate |
| SMILES | CCC(CO)(C(O)OC(=O)CS)C(O)(OC(=O)CS)OC(=O)CS |
| InChI | InChI=1S/C12H20O9S3/c1-2-11(6-13,10(17)19-7(14)3-22)12(18,20-8(15)4-23)21-9(16)5-24/h10,13,17-18,22-24H,2-6H2,1H3 |
| InChIKey | ZQRZUKMWQNNZQR-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|