C8H13NO8S2 — CID 174367311
amino 2-(2-hydroxyethoxy)-2,2-bis[(2-sulfanylacetyl)oxy]acetate (PubChem CID 174367311) has the molecular formula C8H13NO8S2 and a molecular weight of 315.33 g/mol. Its IUPAC name is amino 2-(2-hydroxyethoxy)-2,2-bis[(2-sulfanylacetyl)oxy]acetate.
| Compound Name | amino 2-(2-hydroxyethoxy)-2,2-bis[(2-sulfanylacetyl)oxy]acetate |
|---|---|
| PubChem CID | 174367311 |
| Molecular Formula | C8H13NO8S2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | amino 2-(2-hydroxyethoxy)-2,2-bis[(2-sulfanylacetyl)oxy]acetate |
| SMILES | NOC(=O)C(OCCO)(OC(=O)CS)OC(=O)CS |
| InChI | InChI=1S/C8H13NO8S2/c9-17-7(13)8(14-2-1-10,15-5(11)3-18)16-6(12)4-19/h10,18-19H,1-4,9H2 |
| InChIKey | ZIIBWWBRYQLFRW-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|