C11H12Cl2N4O3 — CID 19882823
1-[2,4-dichloro-5-(methoxymethoxy)phenyl]-4-ethyltetrazol-5-one (PubChem CID 19882823) has the molecular formula C11H12Cl2N4O3 and a molecular weight of 319.15 g/mol. Its IUPAC name is 1-[2,4-dichloro-5-(methoxymethoxy)phenyl]-4-ethyltetrazol-5-one.
| Compound Name | 1-[2,4-dichloro-5-(methoxymethoxy)phenyl]-4-ethyltetrazol-5-one |
|---|---|
| PubChem CID | 19882823 |
| Molecular Formula | C11H12Cl2N4O3 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-[2,4-dichloro-5-(methoxymethoxy)phenyl]-4-ethyltetrazol-5-one |
| SMILES | CCn1nnn(-c2cc(OCOC)c(Cl)cc2Cl)c1=O |
| InChI | InChI=1S/C11H12Cl2N4O3/c1-3-16-11(18)17(15-14-16)9-5-10(20-6-19-2)8(13)4-7(9)12/h4-5H,3,6H2,1-2H3 |
| InChIKey | WHYGNYVFMRXNDJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|