C18H32O4 — CID 19882877
[6-(5-methyl-2-propan-2-ylcyclohexyl)oxyoxan-2-yl]methyl acetate (PubChem CID 19882877) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is [6-(5-methyl-2-propan-2-ylcyclohexyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [6-(5-methyl-2-propan-2-ylcyclohexyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 19882877 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | [6-(5-methyl-2-propan-2-ylcyclohexyl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CCCC(OC2CC(C)CCC2C(C)C)O1 |
| InChI | InChI=1S/C18H32O4/c1-12(2)16-9-8-13(3)10-17(16)22-18-7-5-6-15(21-18)11-20-14(4)19/h12-13,15-18H,5-11H2,1-4H3 |
| InChIKey | HPHVBTMFZULIIS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |