C17H17Br4O4P — CID 19884322
bis(2,4-dibromophenyl) pentyl phosphate (PubChem CID 19884322) has the molecular formula C17H17Br4O4P and a molecular weight of 635.91 g/mol. Its IUPAC name is bis(2,4-dibromophenyl) pentyl phosphate.
| Compound Name | bis(2,4-dibromophenyl) pentyl phosphate |
|---|---|
| PubChem CID | 19884322 |
| Molecular Formula | C17H17Br4O4P |
| Molecular Weight | 635.91 g/mol |
| Exact Mass | 631.76 |
| IUPAC Name | bis(2,4-dibromophenyl) pentyl phosphate |
| SMILES | CCCCCOP(=O)(Oc1ccc(Br)cc1Br)Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C17H17Br4O4P/c1-2-3-4-9-23-26(22,24-16-7-5-12(18)10-14(16)20)25-17-8-6-13(19)11-15(17)21/h5-8,10-11H,2-4,9H2,1H3 |
| InChIKey | PEEHZIXHVGWQEU-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.91 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|