C16H17N3O10 — CID 19884352
methyl 2-[(3,5-dinitrophenyl)carbamoyl]-3-(3-oxobutanoyloxy)butanoate (PubChem CID 19884352) has the molecular formula C16H17N3O10 and a molecular weight of 411.32 g/mol. Its IUPAC name is methyl 2-[(3,5-dinitrophenyl)carbamoyl]-3-(3-oxobutanoyloxy)butanoate.
| Compound Name | methyl 2-[(3,5-dinitrophenyl)carbamoyl]-3-(3-oxobutanoyloxy)butanoate |
|---|---|
| PubChem CID | 19884352 |
| Molecular Formula | C16H17N3O10 |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | methyl 2-[(3,5-dinitrophenyl)carbamoyl]-3-(3-oxobutanoyloxy)butanoate |
| SMILES | COC(=O)C(C(=O)Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(C)OC(=O)CC(C)=O |
| InChI | InChI=1S/C16H17N3O10/c1-8(20)4-13(21)29-9(2)14(16(23)28-3)15(22)17-10-5-11(18(24)25)7-12(6-10)19(26)27/h5-7,9,14H,4H2,1-3H3,(H,17,22) |
| InChIKey | ABFCFDRFLVUWKW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 185.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|