C36H48N2O8 — CID 19884875
[2-acetyloxy-5-[[1-[4-[2-[(3,4-diacetyloxy-5-methylphenyl)methyl]pyrrolidin-1-yl]butyl]pyrrolidin-2-yl]methyl]-3-methylphenyl] acetate (PubChem CID 19884875) has the molecular formula C36H48N2O8 and a molecular weight of 636.79 g/mol. Its IUPAC name is [2-acetyloxy-5-[[1-[4-[2-[(3,4-diacetyloxy-5-methylphenyl)methyl]pyrrolidin-1-yl]butyl]pyrrolidin-2-yl]methyl]-3-methylphenyl] acetate.
| Compound Name | [2-acetyloxy-5-[[1-[4-[2-[(3,4-diacetyloxy-5-methylphenyl)methyl]pyrrolidin-1-yl]butyl]pyrrolidin-2-yl]methyl]-3-methylphenyl] acetate |
|---|---|
| PubChem CID | 19884875 |
| Molecular Formula | C36H48N2O8 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | [2-acetyloxy-5-[[1-[4-[2-[(3,4-diacetyloxy-5-methylphenyl)methyl]pyrrolidin-1-yl]butyl]pyrrolidin-2-yl]methyl]-3-methylphenyl] acetate |
| SMILES | CC(=O)Oc1cc(CC2CCCN2CCCCN2CCCC2Cc2cc(C)c(OC(C)=O)c(OC(C)=O)c2)cc(C)c1OC(C)=O |
| InChI | InChI=1S/C36H48N2O8/c1-23-17-29(21-33(43-25(3)39)35(23)45-27(5)41)19-31-11-9-15-37(31)13-7-8-14-38-16-10-12-32(38)20-30-18-24(2)36(46-28(6)42)34(22-30)44-26(4)40/h17-18,21-22,31-32H,7-16,19-20H2,1-6H3 |
| InChIKey | RNQNLZAJFYAUMD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|