C16H21NO4 — CID 23452567
[2-acetyloxy-4-[(1-methylpyrrolidin-2-yl)methyl]phenyl] acetate (PubChem CID 23452567) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is [2-acetyloxy-4-[(1-methylpyrrolidin-2-yl)methyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[(1-methylpyrrolidin-2-yl)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 23452567 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | [2-acetyloxy-4-[(1-methylpyrrolidin-2-yl)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CC2CCCN2C)cc1OC(C)=O |
| InChI | InChI=1S/C16H21NO4/c1-11(18)20-15-7-6-13(10-16(15)21-12(2)19)9-14-5-4-8-17(14)3/h6-7,10,14H,4-5,8-9H2,1-3H3 |
| InChIKey | NRXGCCBAAFFSPJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|