C15H21NO3 — CID 23339450
2-ethyl-1-methylpyrrolidine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl acetate (PubChem CID 23339450) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-ethyl-1-methylpyrrolidine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl acetate.
| Compound Name | 2-ethyl-1-methylpyrrolidine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl acetate |
|---|---|
| PubChem CID | 23339450 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-ethyl-1-methylpyrrolidine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl acetate |
| SMILES | CC(=O)Oc1cc2ccc1o2.CCC1CCCN1C |
| InChI | InChI=1S/C8H6O3.C7H15N/c1-5(9)10-8-4-6-2-3-7(8)11-6;1-3-7-5-4-6-8(7)2/h2-4H,1H3;7H,3-6H2,1-2H3 |
| InChIKey | NQEMDBVNUJWPFB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|