C10H9Cl2F — CID 19885742
1-(1,1-dichlorobut-1-en-2-yl)-3-fluorobenzene (PubChem CID 19885742) has the molecular formula C10H9Cl2F and a molecular weight of 219.09 g/mol. Its IUPAC name is 1-(1,1-dichlorobut-1-en-2-yl)-3-fluorobenzene.
| Compound Name | 1-(1,1-dichlorobut-1-en-2-yl)-3-fluorobenzene |
|---|---|
| PubChem CID | 19885742 |
| Molecular Formula | C10H9Cl2F |
| Molecular Weight | 219.09 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 1-(1,1-dichlorobut-1-en-2-yl)-3-fluorobenzene |
| SMILES | CCC(=C(Cl)Cl)c1cccc(F)c1 |
| InChI | InChI=1S/C10H9Cl2F/c1-2-9(10(11)12)7-4-3-5-8(13)6-7/h3-6H,2H2,1H3 |
| InChIKey | OFZMUQZMBPKHAB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.09 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |