C27H40N2O5 — CID 19886828
[4-(hexylcarbamoyloxy)-3-propoxynaphthalen-1-yl] N-hexylcarbamate (PubChem CID 19886828) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is [4-(hexylcarbamoyloxy)-3-propoxynaphthalen-1-yl] N-hexylcarbamate.
| Compound Name | [4-(hexylcarbamoyloxy)-3-propoxynaphthalen-1-yl] N-hexylcarbamate |
|---|---|
| PubChem CID | 19886828 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | [4-(hexylcarbamoyloxy)-3-propoxynaphthalen-1-yl] N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)Oc1cc(OCCC)c(OC(=O)NCCCCCC)c2ccccc12 |
| InChI | InChI=1S/C27H40N2O5/c1-4-7-9-13-17-28-26(30)33-23-20-24(32-19-6-3)25(22-16-12-11-15-21(22)23)34-27(31)29-18-14-10-8-5-2/h11-12,15-16,20H,4-10,13-14,17-19H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | BMFMAJUNNOYFSR-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|