C22H30N2O5 — CID 19886837
[4-(butylcarbamoyloxy)-3-ethoxynaphthalen-1-yl] N-butylcarbamate (PubChem CID 19886837) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is [4-(butylcarbamoyloxy)-3-ethoxynaphthalen-1-yl] N-butylcarbamate.
| Compound Name | [4-(butylcarbamoyloxy)-3-ethoxynaphthalen-1-yl] N-butylcarbamate |
|---|---|
| PubChem CID | 19886837 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | [4-(butylcarbamoyloxy)-3-ethoxynaphthalen-1-yl] N-butylcarbamate |
| SMILES | CCCCNC(=O)Oc1cc(OCC)c(OC(=O)NCCCC)c2ccccc12 |
| InChI | InChI=1S/C22H30N2O5/c1-4-7-13-23-21(25)28-18-15-19(27-6-3)20(17-12-10-9-11-16(17)18)29-22(26)24-14-8-5-2/h9-12,15H,4-8,13-14H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | RSZVOQUQEFYXLS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|