C15H17NO4 — CID 19872862
(2-ethoxy-4-methoxynaphthalen-1-yl) N-methylcarbamate (PubChem CID 19872862) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is (2-ethoxy-4-methoxynaphthalen-1-yl) N-methylcarbamate.
| Compound Name | (2-ethoxy-4-methoxynaphthalen-1-yl) N-methylcarbamate |
|---|---|
| PubChem CID | 19872862 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (2-ethoxy-4-methoxynaphthalen-1-yl) N-methylcarbamate |
| SMILES | CCOc1cc(OC)c2ccccc2c1OC(=O)NC |
| InChI | InChI=1S/C15H17NO4/c1-4-19-13-9-12(18-3)10-7-5-6-8-11(10)14(13)20-15(17)16-2/h5-9H,4H2,1-3H3,(H,16,17) |
| InChIKey | GTNPPFBJWWPNKL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |