C26H30N2O5 — CID 19886794
[4-(butylcarbamoyloxy)-3-phenoxynaphthalen-1-yl] N-butylcarbamate (PubChem CID 19886794) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is [4-(butylcarbamoyloxy)-3-phenoxynaphthalen-1-yl] N-butylcarbamate.
| Compound Name | [4-(butylcarbamoyloxy)-3-phenoxynaphthalen-1-yl] N-butylcarbamate |
|---|---|
| PubChem CID | 19886794 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | [4-(butylcarbamoyloxy)-3-phenoxynaphthalen-1-yl] N-butylcarbamate |
| SMILES | CCCCNC(=O)Oc1cc(Oc2ccccc2)c(OC(=O)NCCCC)c2ccccc12 |
| InChI | InChI=1S/C26H30N2O5/c1-3-5-16-27-25(29)32-22-18-23(31-19-12-8-7-9-13-19)24(21-15-11-10-14-20(21)22)33-26(30)28-17-6-4-2/h7-15,18H,3-6,16-17H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | VZLJXHISNVYXLB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|